LIMK1 inhibitor BMS-4 (1 x 5 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 5 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 905298-84-2 |
| Catalog number: | R01EQF4,5mg |
| Molar formula: | O=C(NCC)NC1SC(C2=CC(C3C(C)=CC(OC)=CC=3C)=NC(C3C=NC=CN=3)=N2)=CN=1 |
Alternative products
LIMK1 inhibitor BMS-4 (1 x 1 mg)
- CAS: 905298-84-2
- Cat. No.: R01EQF4,1mg
price excl. vat
€ 2.102,49
Industrial quantities of substances at a discounted price
Ask for a larger quantity
