TDP1 Inhibitor-2 (1 x 5 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 5 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 859142-95-3 |
| Catalog number: | R029QR4,5mg |
| Molar formula: | O=c1oc2cc(OCc3c(Cl)cccc3Cl)ccc2c(c1)c1cc2ccccc2oc1=O |
Alternative products
TDP1 Inhibitor-2 (1 x 1 mg)
- CAS: 859142-95-3
- Cat. No.: R029QR4,1mg
price excl. vat
€ 1.736,21
Industrial quantities of substances at a discounted price
Ask for a larger quantity