1,1'-biphenyl compound with oxydibenzene (1 x 100 g)
| Manufacturer: |
![]() |
|---|---|
| Amount: | 100 g |
| Number of items in the package: | 1 |
| CAS/ID No.: | 8004-13-5 |
| Catalog number: | R003TOZ,100g |
| Molar formula: | C1(C2=CC=CC=C2)=CC=CC=C1.C3(OC4=CC=CC=C4)=CC=CC=C3 |
Alternative products
1,1'-biphenyl compound with oxydibenzene (1 x 500 g)
- CAS: 8004-13-5
- Cat. No.: R003TOZ,500g
price excl. vat
€ 148,39
Industrial quantities of substances at a discounted price
Ask for a larger quantity

