Solvent blue 59 (1 x 1 g)
| Manufacturer: |
 |
|---|---|
| Amount: | 1 g |
| Number of items in the package: | 1 |
| CAS/ID No.: | 6994-46-3 |
| Catalog number: | R006544,1g |
| Molar formula: | CCNc1ccc(c2c1C(=O)c3ccccc3C2=O)NCC |
Alternative products
Solvent blue 59 (1 x 5 g)
- CAS: 6994-46-3
- Cat. No.: R006544,5g
price excl. vat
€ 959,93
Industrial quantities of substances at a discounted price
Ask for a larger quantity