4-Methylphenol, reaction products with dicyclopentadiene and isobutylene (1 x 500 g)
| Manufacturer: |
![]() |
|---|---|
| Amount: | 500 g |
| Number of items in the package: | 1 |
| CAS/ID No.: | 68610-51-5 |
| Catalog number: | R00IULE,500g |
| Molar formula: | Cc1ccc(cc1)O.CC(=C)C.C1C=CC2C1C3CC2C=C3 |
Alternative products
4-Methylphenol, reaction products with dicyclopentadiene and isobutylene (1 x 100 g)
- CAS: 68610-51-5
- Cat. No.: R00IULE,100g
price excl. vat
€ 123,97
Industrial quantities of substances at a discounted price
Ask for a larger quantity


