H1-7 (histone H1 phosphorylation site), PKA Substrate (1 x 5 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 5 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 65189-70-0 |
| Catalog number: | R00E9NI,5mg |
| Molar formula: | NCCCCC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)N1CCCC1C(=O)O)CO)C)NC(=O)C(NC(=O)C(CCCN=C(N)N)N)CCCN=C(N)N |
Alternative products
H1-7 (histone H1 phosphorylation site), PKA Substrate (1 x 1 mg)
- CAS: 65189-70-0
- Cat. No.: R00E9NI,1mg
price excl. vat
€ 398,40
Industrial quantities of substances at a discounted price
Ask for a larger quantity