Aβ42 agonist-2 (1 x 100 mg)
| Manufacturer: |
![]() |
|---|---|
| Amount: | 100 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 6314-40-5 |
| Catalog number: | R02E84B,100mg |
| Molar formula: | O=C(c1cc2c(s1)cccc2)Nc1ccccc1 |
Alternative products
Aβ42 agonist-2 (1 x 250 mg)
- CAS: 6314-40-5
- Cat. No.: R02E84B,250mg
price excl. vat
€ 2.545,94
Industrial quantities of substances at a discounted price
Ask for a larger quantity


