Solvent Violet 8 (1 x 5 g)
| Manufacturer: |
 |
|---|---|
| Amount: | 5 g |
| Number of items in the package: | 1 |
| CAS/ID No.: | 52080-58-7 |
| Catalog number: | R003S32,5g |
| Molar formula: | CN=C1C=CC(=C(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C)C=C1 |
Alternative products
Solvent Violet 8 (1 x 25 g)
- CAS: 52080-58-7
- Cat. No.: R003S32,25g
price excl. vat
€ 258,64
Industrial quantities of substances at a discounted price
Ask for a larger quantity