JNK Inhibitor IX (1 x 50 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 50 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 312917-14-9 |
| Catalog number: | R00C0XD,50mg |
| Molar formula: | O=C(NC1=C(C#N)C(CCCC2)=C2S1)C3=C4C=CC=CC4=CC=C3 |
Alternative products
JNK Inhibitor IX (1 x 10 mg)
- CAS: 312917-14-9
- Cat. No.: R00C0XD,10mg
price excl. vat
€ 273,82
Industrial quantities of substances at a discounted price
Ask for a larger quantity