α5β1 integrin agonist-1 (1 x 1 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 1 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 2756557-83-0 |
| Catalog number: | R02A2OJ,1mg |
| Molar formula: | C([C@@H]1[C@@]([H])([C@@H](C)OC(=O)CCNC(=O)CN2C=C(F)C(=O)NC2=O)C(=O)N1C(=O)NC1C=CC=CC=1C)C(=O)O |
Alternative products
α5β1 integrin agonist-1 (1 x 5 mg)
- CAS: 2756557-83-0
- Cat. No.: R02A2OJ,5mg
price excl. vat
€ 5.877,25
Industrial quantities of substances at a discounted price
Ask for a larger quantity