Glutathione synthesis-IN-1 (1 x 5 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 5 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 2632968-72-8 |
| Catalog number: | R023JLQ,5mg |
| Molar formula: | C(O)(=O)C1=CC(/C=C/C2=CC=C(C3=CC=CC=C3)C=C2)=CC=C1O |
Alternative products
Glutathione synthesis-IN-1 (1 x 25 mg)
- CAS: 2632968-72-8
- Cat. No.: R023JLQ,25mg
price excl. vat
€ 3.862,88
Industrial quantities of substances at a discounted price
Ask for a larger quantity