NFAT Inhibitor-1 (1 x 1 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 1 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 249537-73-3 |
| Catalog number: | R00BERD,1mg |
| Molar formula: | O=C([C@H]1N(CCC1)C(CNC([C@H](C)NC([C@@H](N)CCSC)=O)=O)=O)N[C@@H](CC2=CNC=N2)C(N(CC)[C@@H](C)C(N[C@@H](C(C)C)C(N[C@]([C@@H](C)CC)([H])C(N[C@@H](C(C)C)C(N[C@]([C@@H](C)CC)([H])C(N[C@]([C@H](O)C)([H])C(NCC(N3[C@@H](CCC3)C(N[C@H](C(N[C@@H](CCC(O)=O)C(N[C@H](C(O)=O)CCC(O)=O)=O)=O)CC4=CNC=N4)=O)=O)=O)=O)=O)=O)=O)=O)=O |
Alternative products
NFAT Inhibitor-1 (1 x 10 mg)
- CAS: 249537-73-3
- Cat. No.: R00BERD,10mg
price excl. vat
€ 327,12
Industrial quantities of substances at a discounted price
Ask for a larger quantity
