GLUT Inhibitor-1 (1 x 25 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 25 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 2421141-40-2 |
| Catalog number: | R023JLR,25mg |
| Molar formula: | O=C(COC1C=C(C2=NC3CCN(C4CCC4)CC=3C(NC3=CC=C(C4=CNN=C4)C=C3)=N2)C=CC=1)NC1(CC1)C |
Alternative products
GLUT Inhibitor-1 (1 x 5 mg)
- CAS: 2421141-40-2
- Cat. No.: R023JLR,5mg
price excl. vat
€ 1.380,56
Industrial quantities of substances at a discounted price
Ask for a larger quantity