RORγt Inverse agonist 10 (1 x 1 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 1 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 2413986-35-1 |
| Catalog number: | R024X9L,1mg |
| Molar formula: | C1(C)C=CC(C(=O)NC2C(C)=C(O[C@H]3CCN(C(=O)CC(C(F)(F)F)C(F)(F)F)[C@@H](C)C3)C3=NC=NN3C=2)=CN=1 |
Alternative products
RORγt Inverse agonist 10 (1 x 5 mg)
- CAS: 2413986-35-1
- Cat. No.: R024X9L,5mg
price excl. vat
€ 4.714,99
Industrial quantities of substances at a discounted price
Ask for a larger quantity
