STING agonist-22 (1 x 5 mg)
| Manufacturer: |
![]() |
|---|---|
| Amount: | 5 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 2408723-12-4 |
| Catalog number: | R02A9ML,5mg |
| Molar formula: | CCn1nc(cc1C(=O)Nc1nc2c(n1C/C=C/Cn1c(NC(=O)c3cc(nn3CC)C)nc3c1ncc(c3)C(=O)N)c(OCCCN1CCOCC1)cc(c2)C(=O)N)C |
Alternative products
STING agonist-22 (1 x 1 mg)
- CAS: 2408723-12-4
- Cat. No.: R02A9ML,1mg
price excl. vat
€ 2.456,34
Industrial quantities of substances at a discounted price
Ask for a larger quantity

