Caspase-3 Inhibitor (1 x 5 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 5 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 210344-95-9 |
| Catalog number: | R002KP1,5mg |
| Molar formula: | [C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(=O)OC)C(=O)CF)C(C)C)(NC(=O)[C@@H](NC(=O)OCc1ccccc1)CC(=O)OC)CCC(=O)OC |
Alternative products
Caspase-3 Inhibitor (1 x 10 mg)
- CAS: 210344-95-9
- Cat. No.: R002KP1,10mg
price excl. vat
€ 850,38
Industrial quantities of substances at a discounted price
Ask for a larger quantity
