4-Guanidinobenzoic acid compound with methanesulfonic acid (1:1) (1 x 5 g)
| Manufacturer: |
 |
|---|---|
| Amount: | 5 g |
| Number of items in the package: | 1 |
| CAS/ID No.: | 148720-07-4 |
| Catalog number: | R001L55,5g |
| Molar formula: | O=C(O)C1=CC=C(NC(N)=N)C=C1.CS(=O)(O)=O |
Alternative products
4-Guanidinobenzoic acid compound with methanesulfonic acid (1:1) (1 x 1 g)
- CAS: 148720-07-4
- Cat. No.: R001L55,1g
price excl. vat
€ 154,93
Industrial quantities of substances at a discounted price
Ask for a larger quantity