Endothelial lipase inhibitor-1 (1 x 1 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 1 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 1466427-02-0 |
| Catalog number: | R01MVJF,1mg |
| Molar formula: | C1[C@@H](NC(=O)C2=C(N)C(=O)NC(=O)N2)C2C=CC=C(OCC3C=CC=CC=3)C=2CC1 |
Alternative products
Endothelial lipase inhibitor-1 (1 x 5 mg)
- CAS: 1466427-02-0
- Cat. No.: R01MVJF,5mg
price excl. vat
€ 5.200,66
Industrial quantities of substances at a discounted price
Ask for a larger quantity