Tigecycline USP related compound E (1 x 250 mg)
| Manufacturer: |
![]() |
|---|---|
| Amount: | 250 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 1422262-97-2 |
| Catalog number: | R01V22R,250mg |
| Molar formula: | CC(C)(C)NCC(=O)NC1=CC(=C2CC3CC4C(C(=O)C(=C(C4(C(=O)C3=C(C2=C1O)O)O)O)C(=O)N)N(C)C)N(C)C |
Alternative products
Tigecycline USP related compound E (1 x 100 mg)
- CAS: 1422262-97-2
- Cat. No.: R01V22R,100mg
price excl. vat
€ 17.247,83
Industrial quantities of substances at a discounted price
Ask for a larger quantity


