Solvent Blue 104 (1 x 5 g)
| Manufacturer: |
![]() |
|---|---|
| Amount: | 5 g |
| Number of items in the package: | 1 |
| CAS/ID No.: | 116-75-6 |
| Catalog number: | R01E0GV,5g |
| Molar formula: | C1(=C(C(=CC(=C1)C)C)NC1=CC=C(C=2C(C3=CC=CC=C3C(C12)=O)=O)NC1=C(C=C(C=C1C)C)C)C |
Alternative products
Solvent Blue 104 (1 x 25 g)
- CAS: 116-75-6
- Cat. No.: R01E0GV,25g
price excl. vat
€ 117,79
Industrial quantities of substances at a discounted price
Ask for a larger quantity


