H4R antagonist 3 (1 x 5 mg)
| Manufacturer: |
 |
|---|---|
| Amount: | 5 mg |
| Number of items in the package: | 1 |
| CAS/ID No.: | 1003091-20-0 |
| Catalog number: | R02AOU4,5mg |
| Molar formula: | CN1CCC(CC1)N(c1ncnc2c1c(cs2)c1ccc(cc1)Cl)C |
Alternative products
H4R antagonist 3 (1 x 10 mg)
- CAS: 1003091-20-0
- Cat. No.: R02AOU4,10mg
price excl. vat
€ 942,02
Industrial quantities of substances at a discounted price
Ask for a larger quantity